C24H23Cl2N3O3 — CID 1408064
4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]-N-(3-chlorophenyl)benzamide (PubChem CID 1408064) has the molecular formula C24H23Cl2N3O3 and a molecular weight of 472.37 g/mol. Its IUPAC name is 4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]-N-(3-chlorophenyl)benzamide.
| Compound Name | 4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]-N-(3-chlorophenyl)benzamide |
|---|---|
| PubChem CID | 1408064 |
| Molecular Formula | C24H23Cl2N3O3 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]-N-(3-chlorophenyl)benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccc(CNC2=C(Cl)C(=O)N(C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C24H23Cl2N3O3/c25-17-5-4-6-18(13-17)28-22(30)16-11-9-15(10-12-16)14-27-21-20(26)23(31)29(24(21)32)19-7-2-1-3-8-19/h4-6,9-13,19,27H,1-3,7-8,14H2,(H,28,30) |
| InChIKey | HPPBWFWCABSGQM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|