C29H28ClN5O5S — CID 1408086
4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 1408086) has the molecular formula C29H28ClN5O5S and a molecular weight of 594.09 g/mol. Its IUPAC name is 4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 1408086 |
| Molecular Formula | C29H28ClN5O5S |
| Molecular Weight | 594.09 g/mol |
| Exact Mass | 593.15 |
| IUPAC Name | 4-[[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]methyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1)c1ccc(CNC2=C(Cl)C(=O)N(C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C29H28ClN5O5S/c30-25-26(29(38)35(28(25)37)22-6-2-1-3-7-22)32-18-19-9-11-20(12-10-19)27(36)33-21-13-15-23(16-14-21)41(39,40)34-24-8-4-5-17-31-24/h4-5,8-17,22,32H,1-3,6-7,18H2,(H,31,34)(H,33,36) |
| InChIKey | YWCNDDYNFGHRJG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.09 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|