C24H26N4O5S2 — CID 43909304
4-(piperidin-1-ylsulfonylmethyl)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 43909304) has the molecular formula C24H26N4O5S2 and a molecular weight of 514.63 g/mol. Its IUPAC name is 4-(piperidin-1-ylsulfonylmethyl)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-(piperidin-1-ylsulfonylmethyl)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 43909304 |
| Molecular Formula | C24H26N4O5S2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 4-(piperidin-1-ylsulfonylmethyl)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1)c1ccc(CS(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H26N4O5S2/c29-24(20-9-7-19(8-10-20)18-34(30,31)28-16-4-1-5-17-28)26-21-11-13-22(14-12-21)35(32,33)27-23-6-2-3-15-25-23/h2-3,6-15H,1,4-5,16-18H2,(H,25,27)(H,26,29) |
| InChIKey | ROLDHPCYAFLXKH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |