C29H29N3O5S2 — CID 43904843
N-[4-(naphthalen-1-ylsulfamoyl)phenyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide (PubChem CID 43904843) has the molecular formula C29H29N3O5S2 and a molecular weight of 563.70 g/mol. Its IUPAC name is N-[4-(naphthalen-1-ylsulfamoyl)phenyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide.
| Compound Name | N-[4-(naphthalen-1-ylsulfamoyl)phenyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 43904843 |
| Molecular Formula | C29H29N3O5S2 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | N-[4-(naphthalen-1-ylsulfamoyl)phenyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2cccc3ccccc23)cc1)c1ccc(CS(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C29H29N3O5S2/c33-29(24-13-11-22(12-14-24)21-38(34,35)32-19-4-1-5-20-32)30-25-15-17-26(18-16-25)39(36,37)31-28-10-6-8-23-7-2-3-9-27(23)28/h2-3,6-18,31H,1,4-5,19-21H2,(H,30,33) |
| InChIKey | HNGDUHBWXNURLI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |