C30H31N3O3S — CID 93487102
4-[[(3S)-3-methylpiperidin-1-yl]methyl]-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]benzamide (PubChem CID 93487102) has the molecular formula C30H31N3O3S and a molecular weight of 513.66 g/mol. Its IUPAC name is 4-[[(3S)-3-methylpiperidin-1-yl]methyl]-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-[[(3S)-3-methylpiperidin-1-yl]methyl]-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 93487102 |
| Molecular Formula | C30H31N3O3S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | 4-[[(3S)-3-methylpiperidin-1-yl]methyl]-N-[4-(naphthalen-1-ylsulfamoyl)phenyl]benzamide |
| SMILES | C[C@H]1CCCN(Cc2ccc(C(=O)Nc3ccc(S(=O)(=O)Nc4cccc5ccccc45)cc3)cc2)C1 |
| InChI | InChI=1S/C30H31N3O3S/c1-22-6-5-19-33(20-22)21-23-11-13-25(14-12-23)30(34)31-26-15-17-27(18-16-26)37(35,36)32-29-10-4-8-24-7-2-3-9-28(24)29/h2-4,7-18,22,32H,5-6,19-21H2,1H3,(H,31,34)/t22-/m0/s1 |
| InChIKey | VYZAEODIDVYFKT-QFIPXVFZSA-N |
| XLogP | 6.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |