C25H26FN3O5S2 — CID 99957022
N-[4-[(4-fluorophenyl)sulfamoyl]phenyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide (PubChem CID 99957022) has the molecular formula C25H26FN3O5S2 and a molecular weight of 531.63 g/mol. Its IUPAC name is N-[4-[(4-fluorophenyl)sulfamoyl]phenyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide.
| Compound Name | N-[4-[(4-fluorophenyl)sulfamoyl]phenyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 99957022 |
| Molecular Formula | C25H26FN3O5S2 |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | N-[4-[(4-fluorophenyl)sulfamoyl]phenyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1)c1ccc(CS(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C25H26FN3O5S2/c26-21-8-10-23(11-9-21)28-36(33,34)24-14-12-22(13-15-24)27-25(30)20-6-4-19(5-7-20)18-35(31,32)29-16-2-1-3-17-29/h4-15,28H,1-3,16-18H2,(H,27,30) |
| InChIKey | BWOGMZNNHOOZRP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |