C25H24ClN3O5 — CID 1407834
4-[[3-[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]-4-methylbenzoyl]amino]benzoic acid (PubChem CID 1407834) has the molecular formula C25H24ClN3O5 and a molecular weight of 481.94 g/mol. Its IUPAC name is 4-[[3-[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]-4-methylbenzoyl]amino]benzoic acid.
| Compound Name | 4-[[3-[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]-4-methylbenzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1407834 |
| Molecular Formula | C25H24ClN3O5 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 4-[[3-[(4-chloro-1-cyclohexyl-2,5-dioxopyrrol-3-yl)amino]-4-methylbenzoyl]amino]benzoic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C(=O)O)cc2)cc1NC1=C(Cl)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C25H24ClN3O5/c1-14-7-8-16(22(30)27-17-11-9-15(10-12-17)25(33)34)13-19(14)28-21-20(26)23(31)29(24(21)32)18-5-3-2-4-6-18/h7-13,18,28H,2-6H2,1H3,(H,27,30)(H,33,34) |
| InChIKey | WDRLXZHXFQVWMW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|