C27H22ClN3O6 — CID 1407911
methyl 4-[[3-[[4-chloro-1-(4-methoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]-4-methylbenzoyl]amino]benzoate (PubChem CID 1407911) has the molecular formula C27H22ClN3O6 and a molecular weight of 519.94 g/mol. Its IUPAC name is methyl 4-[[3-[[4-chloro-1-(4-methoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]-4-methylbenzoyl]amino]benzoate.
| Compound Name | methyl 4-[[3-[[4-chloro-1-(4-methoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]-4-methylbenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 1407911 |
| Molecular Formula | C27H22ClN3O6 |
| Molecular Weight | 519.94 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | methyl 4-[[3-[[4-chloro-1-(4-methoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]-4-methylbenzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2ccc(C)c(NC3=C(Cl)C(=O)N(c4ccc(OC)cc4)C3=O)c2)cc1 |
| InChI | InChI=1S/C27H22ClN3O6/c1-15-4-5-17(24(32)29-18-8-6-16(7-9-18)27(35)37-3)14-21(15)30-23-22(28)25(33)31(26(23)34)19-10-12-20(36-2)13-11-19/h4-14,30H,1-3H3,(H,29,32) |
| InChIKey | BKCOZKHRVWVXEK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.94 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|