C28H24ClN3O5 — CID 1407533
ethyl 3-[[3-[[4-chloro-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]-4-methylbenzoyl]amino]benzoate (PubChem CID 1407533) has the molecular formula C28H24ClN3O5 and a molecular weight of 517.97 g/mol. Its IUPAC name is ethyl 3-[[3-[[4-chloro-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]-4-methylbenzoyl]amino]benzoate.
| Compound Name | ethyl 3-[[3-[[4-chloro-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]-4-methylbenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 1407533 |
| Molecular Formula | C28H24ClN3O5 |
| Molecular Weight | 517.97 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | ethyl 3-[[3-[[4-chloro-1-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]-4-methylbenzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)c2ccc(C)c(NC3=C(Cl)C(=O)N(c4ccc(C)cc4)C3=O)c2)c1 |
| InChI | InChI=1S/C28H24ClN3O5/c1-4-37-28(36)19-6-5-7-20(14-19)30-25(33)18-11-10-17(3)22(15-18)31-24-23(29)26(34)32(27(24)35)21-12-8-16(2)9-13-21/h5-15,31H,4H2,1-3H3,(H,30,33) |
| InChIKey | ZDKQPXOFIAQEFN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.97 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|