C19H14Cl2N2O4 — CID 1185278
ethyl 3-[[4-chloro-1-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoate (PubChem CID 1185278) has the molecular formula C19H14Cl2N2O4 and a molecular weight of 405.24 g/mol. Its IUPAC name is ethyl 3-[[4-chloro-1-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoate.
| Compound Name | ethyl 3-[[4-chloro-1-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 1185278 |
| Molecular Formula | C19H14Cl2N2O4 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | ethyl 3-[[4-chloro-1-(4-chlorophenyl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC2=C(Cl)C(=O)N(c3ccc(Cl)cc3)C2=O)c1 |
| InChI | InChI=1S/C19H14Cl2N2O4/c1-2-27-19(26)11-4-3-5-13(10-11)22-16-15(21)17(24)23(18(16)25)14-8-6-12(20)7-9-14/h3-10,22H,2H2,1H3 |
| InChIKey | OIDPZCZQIMQKKP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|