C24H26ClN3O5 — CID 41284896
ethyl 3-[[2-[(4S)-1-(4-chlorophenyl)-3-(2-methylpropyl)-2,5-dioxoimidazolidin-4-yl]acetyl]amino]benzoate (PubChem CID 41284896) has the molecular formula C24H26ClN3O5 and a molecular weight of 471.94 g/mol. Its IUPAC name is ethyl 3-[[2-[(4S)-1-(4-chlorophenyl)-3-(2-methylpropyl)-2,5-dioxoimidazolidin-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 3-[[2-[(4S)-1-(4-chlorophenyl)-3-(2-methylpropyl)-2,5-dioxoimidazolidin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 41284896 |
| Molecular Formula | C24H26ClN3O5 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | ethyl 3-[[2-[(4S)-1-(4-chlorophenyl)-3-(2-methylpropyl)-2,5-dioxoimidazolidin-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)C[C@H]2C(=O)N(c3ccc(Cl)cc3)C(=O)N2CC(C)C)c1 |
| InChI | InChI=1S/C24H26ClN3O5/c1-4-33-23(31)16-6-5-7-18(12-16)26-21(29)13-20-22(30)28(19-10-8-17(25)9-11-19)24(32)27(20)14-15(2)3/h5-12,15,20H,4,13-14H2,1-3H3,(H,26,29)/t20-/m0/s1 |
| InChIKey | ANFJCPYXOJBHHT-FQEVSTJZSA-N |
| XLogP | 4.34 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|