C28H28N4O6 — CID 28701661
ethyl 3-[[2-[(4R)-1-(4-ethoxyphenyl)-2,5-dioxo-3-(pyridin-2-ylmethyl)imidazolidin-4-yl]acetyl]amino]benzoate (PubChem CID 28701661) has the molecular formula C28H28N4O6 and a molecular weight of 516.55 g/mol. Its IUPAC name is ethyl 3-[[2-[(4R)-1-(4-ethoxyphenyl)-2,5-dioxo-3-(pyridin-2-ylmethyl)imidazolidin-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 3-[[2-[(4R)-1-(4-ethoxyphenyl)-2,5-dioxo-3-(pyridin-2-ylmethyl)imidazolidin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 28701661 |
| Molecular Formula | C28H28N4O6 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | ethyl 3-[[2-[(4R)-1-(4-ethoxyphenyl)-2,5-dioxo-3-(pyridin-2-ylmethyl)imidazolidin-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)C[C@@H]2C(=O)N(c3ccc(OCC)cc3)C(=O)N2Cc2ccccn2)c1 |
| InChI | InChI=1S/C28H28N4O6/c1-3-37-23-13-11-22(12-14-23)32-26(34)24(31(28(32)36)18-21-9-5-6-15-29-21)17-25(33)30-20-10-7-8-19(16-20)27(35)38-4-2/h5-16,24H,3-4,17-18H2,1-2H3,(H,30,33)/t24-/m1/s1 |
| InChIKey | QJLYBPDRAJVZGL-XMMPIXPASA-N |
| XLogP | 4.02 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|