C24H22N4O4 — CID 3165084
2-[1-(3-methoxyphenyl)-2,5-dioxo-3-(pyridin-2-ylmethyl)imidazolidin-4-yl]-N-phenylacetamide (PubChem CID 3165084) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is 2-[1-(3-methoxyphenyl)-2,5-dioxo-3-(pyridin-2-ylmethyl)imidazolidin-4-yl]-N-phenylacetamide.
| Compound Name | 2-[1-(3-methoxyphenyl)-2,5-dioxo-3-(pyridin-2-ylmethyl)imidazolidin-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 3165084 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-[1-(3-methoxyphenyl)-2,5-dioxo-3-(pyridin-2-ylmethyl)imidazolidin-4-yl]-N-phenylacetamide |
| SMILES | COc1cccc(N2C(=O)C(CC(=O)Nc3ccccc3)N(Cc3ccccn3)C2=O)c1 |
| InChI | InChI=1S/C24H22N4O4/c1-32-20-12-7-11-19(14-20)28-23(30)21(15-22(29)26-17-8-3-2-4-9-17)27(24(28)31)16-18-10-5-6-13-25-18/h2-14,21H,15-16H2,1H3,(H,26,29) |
| InChIKey | CPJPCSKIJZORQD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|