C21H21Cl2N3O3 — CID 92690531
N-(4-chlorophenyl)-2-[(4R)-1-(4-chlorophenyl)-3-(2-methylpropyl)-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 92690531) has the molecular formula C21H21Cl2N3O3 and a molecular weight of 434.32 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(4R)-1-(4-chlorophenyl)-3-(2-methylpropyl)-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(4R)-1-(4-chlorophenyl)-3-(2-methylpropyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 92690531 |
| Molecular Formula | C21H21Cl2N3O3 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(4R)-1-(4-chlorophenyl)-3-(2-methylpropyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | CC(C)CN1C(=O)N(c2ccc(Cl)cc2)C(=O)[C@H]1CC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21Cl2N3O3/c1-13(2)12-25-18(11-19(27)24-16-7-3-14(22)4-8-16)20(28)26(21(25)29)17-9-5-15(23)6-10-17/h3-10,13,18H,11-12H2,1-2H3,(H,24,27)/t18-/m1/s1 |
| InChIKey | ARGRYAOEGYWIMR-GOSISDBHSA-N |
| XLogP | 4.82 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|