C20H14ClN2O6- — CID 4069598
3-[[4-chloro-1-(2-ethoxycarbonylphenyl)-2,5-dioxopyrrol-3-yl]amino]benzoate (PubChem CID 4069598) has the molecular formula C20H14ClN2O6- and a molecular weight of 413.79 g/mol. Its IUPAC name is 3-[[4-chloro-1-(2-ethoxycarbonylphenyl)-2,5-dioxopyrrol-3-yl]amino]benzoate.
| Compound Name | 3-[[4-chloro-1-(2-ethoxycarbonylphenyl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
|---|---|
| PubChem CID | 4069598 |
| Molecular Formula | C20H14ClN2O6- |
| Molecular Weight | 413.79 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 3-[[4-chloro-1-(2-ethoxycarbonylphenyl)-2,5-dioxopyrrol-3-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1N1C(=O)C(Cl)=C(Nc2cccc(C(=O)[O-])c2)C1=O |
| InChI | InChI=1S/C20H15ClN2O6/c1-2-29-20(28)13-8-3-4-9-14(13)23-17(24)15(21)16(18(23)25)22-12-7-5-6-11(10-12)19(26)27/h3-10,22H,2H2,1H3,(H,26,27)/p-1 |
| InChIKey | NDZFPHPDYISPGU-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.79 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|