C25H26ClN3O5 — CID 1408002
3-[[4-chloro-1-(2,4-dimethoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]-N-cyclopentyl-4-methylbenzamide (PubChem CID 1408002) has the molecular formula C25H26ClN3O5 and a molecular weight of 483.95 g/mol. Its IUPAC name is 3-[[4-chloro-1-(2,4-dimethoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]-N-cyclopentyl-4-methylbenzamide.
| Compound Name | 3-[[4-chloro-1-(2,4-dimethoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]-N-cyclopentyl-4-methylbenzamide |
|---|---|
| PubChem CID | 1408002 |
| Molecular Formula | C25H26ClN3O5 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 3-[[4-chloro-1-(2,4-dimethoxyphenyl)-2,5-dioxopyrrol-3-yl]amino]-N-cyclopentyl-4-methylbenzamide |
| SMILES | COc1ccc(N2C(=O)C(Cl)=C(Nc3cc(C(=O)NC4CCCC4)ccc3C)C2=O)c(OC)c1 |
| InChI | InChI=1S/C25H26ClN3O5/c1-14-8-9-15(23(30)27-16-6-4-5-7-16)12-18(14)28-22-21(26)24(31)29(25(22)32)19-11-10-17(33-2)13-20(19)34-3/h8-13,16,28H,4-7H2,1-3H3,(H,27,30) |
| InChIKey | CMIANAVAXNMEDI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|