C19H17ClN2O4 — CID 1033956
3-chloro-4-(2,4-dimethoxyanilino)-1-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 1033956) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is 3-chloro-4-(2,4-dimethoxyanilino)-1-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-(2,4-dimethoxyanilino)-1-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 1033956 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 3-chloro-4-(2,4-dimethoxyanilino)-1-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(NC2=C(Cl)C(=O)N(c3ccc(C)cc3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C19H17ClN2O4/c1-11-4-6-12(7-5-11)22-18(23)16(20)17(19(22)24)21-14-9-8-13(25-2)10-15(14)26-3/h4-10,21H,1-3H3 |
| InChIKey | FDNWGZIZRHQZFT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|