C29H28ClN3O5 — CID 1408149
4-[[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]methyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide (PubChem CID 1408149) has the molecular formula C29H28ClN3O5 and a molecular weight of 534.01 g/mol. Its IUPAC name is 4-[[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]methyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide.
| Compound Name | 4-[[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]methyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 1408149 |
| Molecular Formula | C29H28ClN3O5 |
| Molecular Weight | 534.01 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 4-[[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]methyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc(CNC3=C(Cl)C(=O)N(Cc4ccccc4)C3=O)cc2)cc1OC |
| InChI | InChI=1S/C29H28ClN3O5/c1-37-23-13-10-19(16-24(23)38-2)14-15-31-27(34)22-11-8-20(9-12-22)17-32-26-25(30)28(35)33(29(26)36)18-21-6-4-3-5-7-21/h3-13,16,32H,14-15,17-18H2,1-2H3,(H,31,34) |
| InChIKey | XARFZGAFQQLHJN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.01 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|