C27H24ClN3O3 — CID 1408090
4-[[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]methyl]-N-ethyl-N-phenylbenzamide (PubChem CID 1408090) has the molecular formula C27H24ClN3O3 and a molecular weight of 473.96 g/mol. Its IUPAC name is 4-[[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]methyl]-N-ethyl-N-phenylbenzamide.
| Compound Name | 4-[[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]methyl]-N-ethyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 1408090 |
| Molecular Formula | C27H24ClN3O3 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 4-[[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]methyl]-N-ethyl-N-phenylbenzamide |
| SMILES | CCN(C(=O)c1ccc(CNC2=C(Cl)C(=O)N(Cc3ccccc3)C2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H24ClN3O3/c1-2-30(22-11-7-4-8-12-22)25(32)21-15-13-19(14-16-21)17-29-24-23(28)26(33)31(27(24)34)18-20-9-5-3-6-10-20/h3-16,29H,2,17-18H2,1H3 |
| InChIKey | QUHURBMQWYDBGC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|