C26H20ClN3O5 — CID 1194869
methyl 3-[[3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]benzoyl]amino]benzoate (PubChem CID 1194869) has the molecular formula C26H20ClN3O5 and a molecular weight of 489.92 g/mol. Its IUPAC name is methyl 3-[[3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]benzoyl]amino]benzoate.
| Compound Name | methyl 3-[[3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 1194869 |
| Molecular Formula | C26H20ClN3O5 |
| Molecular Weight | 489.92 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | methyl 3-[[3-[(1-benzyl-4-chloro-2,5-dioxopyrrol-3-yl)amino]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cccc(NC3=C(Cl)C(=O)N(Cc4ccccc4)C3=O)c2)c1 |
| InChI | InChI=1S/C26H20ClN3O5/c1-35-26(34)18-10-6-12-20(14-18)29-23(31)17-9-5-11-19(13-17)28-22-21(27)24(32)30(25(22)33)15-16-7-3-2-4-8-16/h2-14,28H,15H2,1H3,(H,29,31) |
| InChIKey | NDLOFVBNOPRUKK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.92 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|