C16H12ClNO3S — CID 110582751
1-[2-(4-chlorophenyl)ethyl]-3-hydroxy-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110582751) has the molecular formula C16H12ClNO3S and a molecular weight of 333.80 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-hydroxy-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-hydroxy-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110582751 |
| Molecular Formula | C16H12ClNO3S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-hydroxy-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | O=C1C(O)=C(c2cccs2)C(=O)N1CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12ClNO3S/c17-11-5-3-10(4-6-11)7-8-18-15(20)13(14(19)16(18)21)12-2-1-9-22-12/h1-6,9,19H,7-8H2 |
| InChIKey | LWEDNRHOFOEGTM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|