C24H22ClN3O2S — CID 110590447
1-[2-(4-chlorophenyl)ethyl]-3-[4-(dimethylamino)anilino]-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110590447) has the molecular formula C24H22ClN3O2S and a molecular weight of 451.98 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-[4-(dimethylamino)anilino]-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-[4-(dimethylamino)anilino]-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110590447 |
| Molecular Formula | C24H22ClN3O2S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-[4-(dimethylamino)anilino]-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CN(C)c1ccc(NC2=C(c3cccs3)C(=O)N(CCc3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H22ClN3O2S/c1-27(2)19-11-9-18(10-12-19)26-22-21(20-4-3-15-31-20)23(29)28(24(22)30)14-13-16-5-7-17(25)8-6-16/h3-12,15,26H,13-14H2,1-2H3 |
| InChIKey | FKUCVXRTYZCNTJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|