C16H15NO — CID 82039937
4-(1,2-dimethylindol-3-yl)phenol (PubChem CID 82039937) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-(1,2-dimethylindol-3-yl)phenol.
| Compound Name | 4-(1,2-dimethylindol-3-yl)phenol |
|---|---|
| PubChem CID | 82039937 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 4-(1,2-dimethylindol-3-yl)phenol |
| SMILES | Cc1c(-c2ccc(O)cc2)c2ccccc2n1C |
| InChI | InChI=1S/C16H15NO/c1-11-16(12-7-9-13(18)10-8-12)14-5-3-4-6-15(14)17(11)2/h3-10,18H,1-2H3 |
| InChIKey | ZOFSDWRXYORQSI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |