C16H19N — CID 15619846
3-(cyclohexen-1-yl)-1,2-dimethylindole (PubChem CID 15619846) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is 3-(cyclohexen-1-yl)-1,2-dimethylindole.
| Compound Name | 3-(cyclohexen-1-yl)-1,2-dimethylindole |
|---|---|
| PubChem CID | 15619846 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 3-(cyclohexen-1-yl)-1,2-dimethylindole |
| SMILES | Cc1c(C2=CCCCC2)c2ccccc2n1C |
| InChI | InChI=1S/C16H19N/c1-12-16(13-8-4-3-5-9-13)14-10-6-7-11-15(14)17(12)2/h6-8,10-11H,3-5,9H2,1-2H3 |
| InChIKey | MSVMOCJLLRZSSM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |