C24H20N2O2 — CID 126480670
3,4-bis(1,2-dimethylindol-3-yl)cyclobut-3-ene-1,2-dione (PubChem CID 126480670) has the molecular formula C24H20N2O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 3,4-bis(1,2-dimethylindol-3-yl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3,4-bis(1,2-dimethylindol-3-yl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 126480670 |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3,4-bis(1,2-dimethylindol-3-yl)cyclobut-3-ene-1,2-dione |
| SMILES | Cc1c(-c2c(-c3c(C)n(C)c4ccccc34)c(=O)c2=O)c2ccccc2n1C |
| InChI | InChI=1S/C24H20N2O2/c1-13-19(15-9-5-7-11-17(15)25(13)3)21-22(24(28)23(21)27)20-14(2)26(4)18-12-8-6-10-16(18)20/h5-12H,1-4H3 |
| InChIKey | OTCDUSQZUFUOPC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|