C25H22N2O — CID 41031701
(3R)-2-benzyl-3-(1,2-dimethylindol-3-yl)-3H-isoindol-1-one (PubChem CID 41031701) has the molecular formula C25H22N2O and a molecular weight of 366.46 g/mol. Its IUPAC name is (3R)-2-benzyl-3-(1,2-dimethylindol-3-yl)-3H-isoindol-1-one.
| Compound Name | (3R)-2-benzyl-3-(1,2-dimethylindol-3-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 41031701 |
| Molecular Formula | C25H22N2O |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (3R)-2-benzyl-3-(1,2-dimethylindol-3-yl)-3H-isoindol-1-one |
| SMILES | Cc1c([C@H]2c3ccccc3C(=O)N2Cc2ccccc2)c2ccccc2n1C |
| InChI | InChI=1S/C25H22N2O/c1-17-23(21-14-8-9-15-22(21)26(17)2)24-19-12-6-7-13-20(19)25(28)27(24)16-18-10-4-3-5-11-18/h3-15,24H,16H2,1-2H3/t24-/m1/s1 |
| InChIKey | KQZADWOKYZJWSG-XMMPIXPASA-N |
| XLogP | 5.23 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|