C30H23FN2O — CID 41031789
(3R)-2-benzyl-3-[2-(4-fluorophenyl)-1-methylindol-3-yl]-3H-isoindol-1-one (PubChem CID 41031789) has the molecular formula C30H23FN2O and a molecular weight of 446.53 g/mol. Its IUPAC name is (3R)-2-benzyl-3-[2-(4-fluorophenyl)-1-methylindol-3-yl]-3H-isoindol-1-one.
| Compound Name | (3R)-2-benzyl-3-[2-(4-fluorophenyl)-1-methylindol-3-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 41031789 |
| Molecular Formula | C30H23FN2O |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (3R)-2-benzyl-3-[2-(4-fluorophenyl)-1-methylindol-3-yl]-3H-isoindol-1-one |
| SMILES | Cn1c(-c2ccc(F)cc2)c([C@H]2c3ccccc3C(=O)N2Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C30H23FN2O/c1-32-26-14-8-7-13-25(26)27(28(32)21-15-17-22(31)18-16-21)29-23-11-5-6-12-24(23)30(34)33(29)19-20-9-3-2-4-10-20/h2-18,29H,19H2,1H3/t29-/m1/s1 |
| InChIKey | BTXVLAIUJIPDLV-GDLZYMKVSA-N |
| XLogP | 6.73 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |