C29H21FN2O — CID 41031655
(3S)-2-[(4-fluorophenyl)methyl]-3-(2-phenyl-1H-indol-3-yl)-3H-isoindol-1-one (PubChem CID 41031655) has the molecular formula C29H21FN2O and a molecular weight of 432.50 g/mol. Its IUPAC name is (3S)-2-[(4-fluorophenyl)methyl]-3-(2-phenyl-1H-indol-3-yl)-3H-isoindol-1-one.
| Compound Name | (3S)-2-[(4-fluorophenyl)methyl]-3-(2-phenyl-1H-indol-3-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 41031655 |
| Molecular Formula | C29H21FN2O |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (3S)-2-[(4-fluorophenyl)methyl]-3-(2-phenyl-1H-indol-3-yl)-3H-isoindol-1-one |
| SMILES | O=C1c2ccccc2[C@@H](c2c(-c3ccccc3)[nH]c3ccccc23)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C29H21FN2O/c30-21-16-14-19(15-17-21)18-32-28(22-10-4-5-11-23(22)29(32)33)26-24-12-6-7-13-25(24)31-27(26)20-8-2-1-3-9-20/h1-17,28,31H,18H2/t28-/m0/s1 |
| InChIKey | HOJUOBZONUGVSB-NDEPHWFRSA-N |
| XLogP | 6.72 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |