C27H20N2O2 — CID 7355435
(3S)-2-(furan-2-ylmethyl)-3-(2-phenyl-1H-indol-3-yl)-3H-isoindol-1-one (PubChem CID 7355435) has the molecular formula C27H20N2O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is (3S)-2-(furan-2-ylmethyl)-3-(2-phenyl-1H-indol-3-yl)-3H-isoindol-1-one.
| Compound Name | (3S)-2-(furan-2-ylmethyl)-3-(2-phenyl-1H-indol-3-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 7355435 |
| Molecular Formula | C27H20N2O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (3S)-2-(furan-2-ylmethyl)-3-(2-phenyl-1H-indol-3-yl)-3H-isoindol-1-one |
| SMILES | O=C1c2ccccc2[C@@H](c2c(-c3ccccc3)[nH]c3ccccc23)N1Cc1ccco1 |
| InChI | InChI=1S/C27H20N2O2/c30-27-21-13-5-4-12-20(21)26(29(27)17-19-11-8-16-31-19)24-22-14-6-7-15-23(22)28-25(24)18-9-2-1-3-10-18/h1-16,26,28H,17H2/t26-/m0/s1 |
| InChIKey | VHYXHXYFVGMLNZ-SANMLTNESA-N |
| XLogP | 6.17 |
| TPSA | 49.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |