C22H24N2O — CID 41031698
(3S)-2-butyl-3-(1,2-dimethylindol-3-yl)-3H-isoindol-1-one (PubChem CID 41031698) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is (3S)-2-butyl-3-(1,2-dimethylindol-3-yl)-3H-isoindol-1-one.
| Compound Name | (3S)-2-butyl-3-(1,2-dimethylindol-3-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 41031698 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (3S)-2-butyl-3-(1,2-dimethylindol-3-yl)-3H-isoindol-1-one |
| SMILES | CCCCN1C(=O)c2ccccc2[C@H]1c1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C22H24N2O/c1-4-5-14-24-21(16-10-6-7-11-17(16)22(24)25)20-15(2)23(3)19-13-9-8-12-18(19)20/h6-13,21H,4-5,14H2,1-3H3/t21-/m0/s1 |
| InChIKey | PKWQHYZIJZWOED-NRFANRHFSA-N |
| XLogP | 4.83 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|