C25H29N3O2 — CID 3966369
2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N,N-diethylpropanamide (PubChem CID 3966369) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N,N-diethylpropanamide.
| Compound Name | 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 3966369 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)N1C(=O)c2ccccc2C1c1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C25H29N3O2/c1-6-27(7-2)24(29)17(4)28-23(18-12-8-9-13-19(18)25(28)30)22-16(3)26(5)21-15-11-10-14-20(21)22/h8-15,17,23H,6-7H2,1-5H3 |
| InChIKey | ZQZKEDDDKDGCSR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|