C27H26N4O2 — CID 3991047
2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N'-phenylpropanehydrazide (PubChem CID 3991047) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N'-phenylpropanehydrazide.
| Compound Name | 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N'-phenylpropanehydrazide |
|---|---|
| PubChem CID | 3991047 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N'-phenylpropanehydrazide |
| SMILES | Cc1c(C2c3ccccc3C(=O)N2C(C)C(=O)NNc2ccccc2)c2ccccc2n1C |
| InChI | InChI=1S/C27H26N4O2/c1-17-24(22-15-9-10-16-23(22)30(17)3)25-20-13-7-8-14-21(20)27(33)31(25)18(2)26(32)29-28-19-11-5-4-6-12-19/h4-16,18,25,28H,1-3H3,(H,29,32) |
| InChIKey | LSAKSEAPEXDONC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|