C32H34N4O3 — CID 4026457
3-(1,2-dimethylindol-3-yl)-2-[1-[4-(2-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3H-isoindol-1-one (PubChem CID 4026457) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is 3-(1,2-dimethylindol-3-yl)-2-[1-[4-(2-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3H-isoindol-1-one.
| Compound Name | 3-(1,2-dimethylindol-3-yl)-2-[1-[4-(2-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 4026457 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 3-(1,2-dimethylindol-3-yl)-2-[1-[4-(2-methoxyphenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3H-isoindol-1-one |
| SMILES | COc1ccccc1N1CCN(C(=O)C(C)N2C(=O)c3ccccc3C2c2c(C)n(C)c3ccccc23)CC1 |
| InChI | InChI=1S/C32H34N4O3/c1-21-29(25-13-7-8-14-26(25)33(21)3)30-23-11-5-6-12-24(23)32(38)36(30)22(2)31(37)35-19-17-34(18-20-35)27-15-9-10-16-28(27)39-4/h5-16,22,30H,17-20H2,1-4H3 |
| InChIKey | RDCAXRBKHCIEIM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 58.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|