C30H30N4O3 — CID 34909603
(3R)-2-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-(2-methyl-1H-indol-3-yl)-3H-isoindol-1-one (PubChem CID 34909603) has the molecular formula C30H30N4O3 and a molecular weight of 494.60 g/mol. Its IUPAC name is (3R)-2-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-(2-methyl-1H-indol-3-yl)-3H-isoindol-1-one.
| Compound Name | (3R)-2-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-(2-methyl-1H-indol-3-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 34909603 |
| Molecular Formula | C30H30N4O3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | (3R)-2-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-(2-methyl-1H-indol-3-yl)-3H-isoindol-1-one |
| SMILES | COc1ccccc1N1CCN(C(=O)CN2C(=O)c3ccccc3[C@@H]2c2c(C)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C30H30N4O3/c1-20-28(23-11-5-6-12-24(23)31-20)29-21-9-3-4-10-22(21)30(36)34(29)19-27(35)33-17-15-32(16-18-33)25-13-7-8-14-26(25)37-2/h3-14,29,31H,15-19H2,1-2H3/t29-/m1/s1 |
| InChIKey | AJYNIKSRCBZAML-GDLZYMKVSA-N |
| XLogP | 4.38 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|