C30H29FN4O2 — CID 3969400
3-(1,2-dimethylindol-3-yl)-2-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-3H-isoindol-1-one (PubChem CID 3969400) has the molecular formula C30H29FN4O2 and a molecular weight of 496.59 g/mol. Its IUPAC name is 3-(1,2-dimethylindol-3-yl)-2-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-3H-isoindol-1-one.
| Compound Name | 3-(1,2-dimethylindol-3-yl)-2-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 3969400 |
| Molecular Formula | C30H29FN4O2 |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 3-(1,2-dimethylindol-3-yl)-2-[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-3H-isoindol-1-one |
| SMILES | Cc1c(C2c3ccccc3C(=O)N2CC(=O)N2CCN(c3ccccc3F)CC2)c2ccccc2n1C |
| InChI | InChI=1S/C30H29FN4O2/c1-20-28(23-11-5-7-13-25(23)32(20)2)29-21-9-3-4-10-22(21)30(37)35(29)19-27(36)34-17-15-33(16-18-34)26-14-8-6-12-24(26)31/h3-14,29H,15-19H2,1-2H3 |
| InChIKey | FZRHMSTWFIAJTF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 48.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|