C29H28N4O2 — CID 40964690
(3R)-3-(1-methylindol-3-yl)-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3H-isoindol-1-one (PubChem CID 40964690) has the molecular formula C29H28N4O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is (3R)-3-(1-methylindol-3-yl)-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3H-isoindol-1-one.
| Compound Name | (3R)-3-(1-methylindol-3-yl)-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 40964690 |
| Molecular Formula | C29H28N4O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (3R)-3-(1-methylindol-3-yl)-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3H-isoindol-1-one |
| SMILES | Cn1cc([C@H]2c3ccccc3C(=O)N2CC(=O)N2CCN(c3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C29H28N4O2/c1-30-19-25(22-11-7-8-14-26(22)30)28-23-12-5-6-13-24(23)29(35)33(28)20-27(34)32-17-15-31(16-18-32)21-9-3-2-4-10-21/h2-14,19,28H,15-18,20H2,1H3/t28-/m1/s1 |
| InChIKey | ZOYAUPCZDMLHEG-MUUNZHRXSA-N |
| XLogP | 4.07 |
| TPSA | 48.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |