C28H35N3O2 — CID 4667572
2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-octan-2-ylacetamide (PubChem CID 4667572) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-octan-2-ylacetamide.
| Compound Name | 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-octan-2-ylacetamide |
|---|---|
| PubChem CID | 4667572 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-octan-2-ylacetamide |
| SMILES | CCCCCCC(C)NC(=O)CN1C(=O)c2ccccc2C1c1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C28H35N3O2/c1-5-6-7-8-13-19(2)29-25(32)18-31-27(21-14-9-10-15-22(21)28(31)33)26-20(3)30(4)24-17-12-11-16-23(24)26/h9-12,14-17,19,27H,5-8,13,18H2,1-4H3,(H,29,32) |
| InChIKey | LCSNPKSHFYOVTL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|