C27H22F3N3O2 — CID 3979381
2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 3979381) has the molecular formula C27H22F3N3O2 and a molecular weight of 477.49 g/mol. Its IUPAC name is 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3979381 |
| Molecular Formula | C27H22F3N3O2 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1c(C2c3ccccc3C(=O)N2CC(=O)Nc2cccc(C(F)(F)F)c2)c2ccccc2n1C |
| InChI | InChI=1S/C27H22F3N3O2/c1-16-24(21-12-5-6-13-22(21)32(16)2)25-19-10-3-4-11-20(19)26(35)33(25)15-23(34)31-18-9-7-8-17(14-18)27(28,29)30/h3-14,25H,15H2,1-2H3,(H,31,34) |
| InChIKey | YQKPZWBWXCSSBK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|