C21H19F3N2O3 — CID 20862014
4-(1-methyl-2-oxoquinolin-4-yl)oxy-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 20862014) has the molecular formula C21H19F3N2O3 and a molecular weight of 404.39 g/mol. Its IUPAC name is 4-(1-methyl-2-oxoquinolin-4-yl)oxy-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 4-(1-methyl-2-oxoquinolin-4-yl)oxy-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 20862014 |
| Molecular Formula | C21H19F3N2O3 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 4-(1-methyl-2-oxoquinolin-4-yl)oxy-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | Cn1c(=O)cc(OCCCC(=O)Nc2cccc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C21H19F3N2O3/c1-26-17-9-3-2-8-16(17)18(13-20(26)28)29-11-5-10-19(27)25-15-7-4-6-14(12-15)21(22,23)24/h2-4,6-9,12-13H,5,10-11H2,1H3,(H,25,27) |
| InChIKey | MBTZPOAHUSXGKN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|