C19H14ClF3N2O2S — CID 20856523
2-(7-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 20856523) has the molecular formula C19H14ClF3N2O2S and a molecular weight of 426.85 g/mol. Its IUPAC name is 2-(7-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(7-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 20856523 |
| Molecular Formula | C19H14ClF3N2O2S |
| Molecular Weight | 426.85 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 2-(7-chloro-1-methyl-2-oxoquinolin-4-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cn1c(=O)cc(SCC(=O)Nc2cccc(C(F)(F)F)c2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H14ClF3N2O2S/c1-25-15-8-12(20)5-6-14(15)16(9-18(25)27)28-10-17(26)24-13-4-2-3-11(7-13)19(21,22)23/h2-9H,10H2,1H3,(H,24,26) |
| InChIKey | PFKZZTDNSJMVAD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.85 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |