C18H15F3N2OS — CID 3715457
2-(1-methylindol-3-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 3715457) has the molecular formula C18H15F3N2OS and a molecular weight of 364.39 g/mol. Its IUPAC name is 2-(1-methylindol-3-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(1-methylindol-3-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3715457 |
| Molecular Formula | C18H15F3N2OS |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 2-(1-methylindol-3-yl)sulfanyl-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cn1cc(SCC(=O)Nc2cccc(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C18H15F3N2OS/c1-23-10-16(14-7-2-3-8-15(14)23)25-11-17(24)22-13-6-4-5-12(9-13)18(19,20)21/h2-10H,11H2,1H3,(H,22,24) |
| InChIKey | NUZVMZPGYRVQTL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |