C21H20N2O3 — CID 7346320
methyl 2-[(1S)-1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]acetate (PubChem CID 7346320) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl 2-[(1S)-1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]acetate.
| Compound Name | methyl 2-[(1S)-1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]acetate |
|---|---|
| PubChem CID | 7346320 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | methyl 2-[(1S)-1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]acetate |
| SMILES | COC(=O)CN1C(=O)c2ccccc2[C@H]1c1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C21H20N2O3/c1-13-19(16-10-6-7-11-17(16)22(13)2)20-14-8-4-5-9-15(14)21(25)23(20)12-18(24)26-3/h4-11,20H,12H2,1-3H3/t20-/m0/s1 |
| InChIKey | JHVMTGSTEGRMNY-FQEVSTJZSA-N |
| XLogP | 3.20 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|