C29H22N2O3 — CID 41002685
methyl 2-[(1R)-1-(2-naphthalen-2-yl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetate (PubChem CID 41002685) has the molecular formula C29H22N2O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is methyl 2-[(1R)-1-(2-naphthalen-2-yl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetate.
| Compound Name | methyl 2-[(1R)-1-(2-naphthalen-2-yl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetate |
|---|---|
| PubChem CID | 41002685 |
| Molecular Formula | C29H22N2O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | methyl 2-[(1R)-1-(2-naphthalen-2-yl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetate |
| SMILES | COC(=O)CN1C(=O)c2ccccc2[C@@H]1c1c(-c2ccc3ccccc3c2)[nH]c2ccccc12 |
| InChI | InChI=1S/C29H22N2O3/c1-34-25(32)17-31-28(21-10-4-5-11-22(21)29(31)33)26-23-12-6-7-13-24(23)30-27(26)20-15-14-18-8-2-3-9-19(18)16-20/h2-16,28,30H,17H2,1H3/t28-/m1/s1 |
| InChIKey | OFQNAXSYPWTZJA-MUUNZHRXSA-N |
| XLogP | 5.71 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |