C34H39N3O2 — CID 5184957
2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-3-methyl-N-(4-phenylbutan-2-yl)pentanamide (PubChem CID 5184957) has the molecular formula C34H39N3O2 and a molecular weight of 521.71 g/mol. Its IUPAC name is 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-3-methyl-N-(4-phenylbutan-2-yl)pentanamide.
| Compound Name | 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-3-methyl-N-(4-phenylbutan-2-yl)pentanamide |
|---|---|
| PubChem CID | 5184957 |
| Molecular Formula | C34H39N3O2 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | 2-[1-(1,2-dimethylindol-3-yl)-3-oxo-1H-isoindol-2-yl]-3-methyl-N-(4-phenylbutan-2-yl)pentanamide |
| SMILES | CCC(C)C(C(=O)NC(C)CCc1ccccc1)N1C(=O)c2ccccc2C1c1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C34H39N3O2/c1-6-22(2)31(33(38)35-23(3)20-21-25-14-8-7-9-15-25)37-32(26-16-10-11-17-27(26)34(37)39)30-24(4)36(5)29-19-13-12-18-28(29)30/h7-19,22-23,31-32H,6,20-21H2,1-5H3,(H,35,38) |
| InChIKey | GKCXPEXIJRZFFH-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|