C24H27N5O3 — CID 3877424
[[3-methyl-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanoyl]amino]urea (PubChem CID 3877424) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is [[3-methyl-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanoyl]amino]urea.
| Compound Name | [[3-methyl-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanoyl]amino]urea |
|---|---|
| PubChem CID | 3877424 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | [[3-methyl-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanoyl]amino]urea |
| SMILES | CCC(C)C(C(=O)NNC(N)=O)N1C(=O)c2ccccc2C1c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C24H27N5O3/c1-4-13(2)20(22(30)27-28-24(25)32)29-21(15-9-5-6-10-16(15)23(29)31)19-14(3)26-18-12-8-7-11-17(18)19/h5-13,20-21,26H,4H2,1-3H3,(H,27,30)(H3,25,28,32) |
| InChIKey | YLIMYFADVWHTGV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|