C27H34N4O2 — CID 3899803
N-[3-(diethylamino)propyl]-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]propanamide (PubChem CID 3899803) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]propanamide.
| Compound Name | N-[3-(diethylamino)propyl]-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]propanamide |
|---|---|
| PubChem CID | 3899803 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]propanamide |
| SMILES | CCN(CC)CCCNC(=O)C(C)N1C(=O)c2ccccc2C1c1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C27H34N4O2/c1-5-30(6-2)17-11-16-28-26(32)19(4)31-25(20-12-7-8-13-21(20)27(31)33)24-18(3)29-23-15-10-9-14-22(23)24/h7-10,12-15,19,25,29H,5-6,11,16-17H2,1-4H3,(H,28,32) |
| InChIKey | ZCJDIAUBVYZQRF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|