C28H35N3O2 — CID 4590908
4-methyl-N-(3-methylbutyl)-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanamide (PubChem CID 4590908) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 4-methyl-N-(3-methylbutyl)-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanamide.
| Compound Name | 4-methyl-N-(3-methylbutyl)-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanamide |
|---|---|
| PubChem CID | 4590908 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 4-methyl-N-(3-methylbutyl)-2-[1-(2-methyl-1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]pentanamide |
| SMILES | Cc1[nH]c2ccccc2c1C1c2ccccc2C(=O)N1C(CC(C)C)C(=O)NCCC(C)C |
| InChI | InChI=1S/C28H35N3O2/c1-17(2)14-15-29-27(32)24(16-18(3)4)31-26(20-10-6-7-11-21(20)28(31)33)25-19(5)30-23-13-9-8-12-22(23)25/h6-13,17-18,24,26,30H,14-16H2,1-5H3,(H,29,32) |
| InChIKey | DMTZAMRCOUIUNZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|