C36H42N4O3 — CID 5182161
4-methyl-2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]-N-(3-morpholin-4-ylpropyl)pentanamide (PubChem CID 5182161) has the molecular formula C36H42N4O3 and a molecular weight of 578.76 g/mol. Its IUPAC name is 4-methyl-2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]-N-(3-morpholin-4-ylpropyl)pentanamide.
| Compound Name | 4-methyl-2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]-N-(3-morpholin-4-ylpropyl)pentanamide |
|---|---|
| PubChem CID | 5182161 |
| Molecular Formula | C36H42N4O3 |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | 4-methyl-2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]-N-(3-morpholin-4-ylpropyl)pentanamide |
| SMILES | Cc1ccc(-c2[nH]c3ccccc3c2C2c3ccccc3C(=O)N2C(CC(C)C)C(=O)NCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C36H42N4O3/c1-24(2)23-31(35(41)37-17-8-18-39-19-21-43-22-20-39)40-34(27-9-4-5-10-28(27)36(40)42)32-29-11-6-7-12-30(29)38-33(32)26-15-13-25(3)14-16-26/h4-7,9-16,24,31,34,38H,8,17-23H2,1-3H3,(H,37,41) |
| InChIKey | ZUXFMBNORSXMLR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|