C30H30N4O3 — CID 5039723
N-[[3-methyl-2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]pentanoyl]amino]formamide (PubChem CID 5039723) has the molecular formula C30H30N4O3 and a molecular weight of 494.60 g/mol. Its IUPAC name is N-[[3-methyl-2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]pentanoyl]amino]formamide.
| Compound Name | N-[[3-methyl-2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]pentanoyl]amino]formamide |
|---|---|
| PubChem CID | 5039723 |
| Molecular Formula | C30H30N4O3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | N-[[3-methyl-2-[1-[2-(4-methylphenyl)-1H-indol-3-yl]-3-oxo-1H-isoindol-2-yl]pentanoyl]amino]formamide |
| SMILES | CCC(C)C(C(=O)NNC=O)N1C(=O)c2ccccc2C1c1c(-c2ccc(C)cc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C30H30N4O3/c1-4-19(3)27(29(36)33-31-17-35)34-28(21-9-5-6-10-22(21)30(34)37)25-23-11-7-8-12-24(23)32-26(25)20-15-13-18(2)14-16-20/h5-17,19,27-28,32H,4H2,1-3H3,(H,31,35)(H,33,36) |
| InChIKey | KNBBKBMWIBFJEF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|