C36H43N3O2 — CID 4021675
3-methyl-N-octan-2-yl-2-[3-oxo-1-(2-phenyl-1H-indol-3-yl)-1H-isoindol-2-yl]pentanamide (PubChem CID 4021675) has the molecular formula C36H43N3O2 and a molecular weight of 549.76 g/mol. Its IUPAC name is 3-methyl-N-octan-2-yl-2-[3-oxo-1-(2-phenyl-1H-indol-3-yl)-1H-isoindol-2-yl]pentanamide.
| Compound Name | 3-methyl-N-octan-2-yl-2-[3-oxo-1-(2-phenyl-1H-indol-3-yl)-1H-isoindol-2-yl]pentanamide |
|---|---|
| PubChem CID | 4021675 |
| Molecular Formula | C36H43N3O2 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | 3-methyl-N-octan-2-yl-2-[3-oxo-1-(2-phenyl-1H-indol-3-yl)-1H-isoindol-2-yl]pentanamide |
| SMILES | CCCCCCC(C)NC(=O)C(C(C)CC)N1C(=O)c2ccccc2C1c1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C36H43N3O2/c1-5-7-8-10-17-25(4)37-35(40)33(24(3)6-2)39-34(27-20-13-14-21-28(27)36(39)41)31-29-22-15-16-23-30(29)38-32(31)26-18-11-9-12-19-26/h9,11-16,18-25,33-34,38H,5-8,10,17H2,1-4H3,(H,37,40) |
| InChIKey | QGVKZJCSWRXBSK-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|